![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1 - Overview of GST ..> | 2014-09-08 22:29 | 110M | |
| cost trip to kulim&k..> | 2015-03-16 11:21 | 17K | |
| SPS Training manual...> | 2015-05-08 17:37 | 1.4M | |
| update_to_14_01_03.zip | 2015-06-16 15:46 | 1.2M | |
| iaccountdb.sql | 2015-06-26 16:38 | 83K | |
| update_to_14_01_04.zip | 2015-07-24 15:06 | 392K | |
| nhdb20160519.sql | 2016-05-19 18:04 | 6.1M | |
| FR Salihin SPS PI1M ..> | 2016-10-27 14:05 | 7.5M | |
| SPS SALE RECORD 10...> | 2016-12-13 16:53 | 11K | |
| sps2912(2).pptx | 2016-12-29 15:24 | 88K | |
| International strate..> | 2017-01-07 18:08 | 1.1M | |
| SPS Business Proposa..> | 2017-01-12 11:02 | 6.5M | |
| Cost Audit Scoreboar..> | 2017-01-19 16:14 | 18K | |
| Company Structure-15..> | 2017-02-15 14:41 | 13K | |
| Company status.docx | 2017-02-15 17:53 | 17K | |
| development spslite.txt | 2017-03-01 18:31 | 54 | |
| SPS Audit ScoreBoard..> | 2017-03-13 18:02 | 4.7M | |
| 2017 SPS Update & Pl..> | 2017-03-15 17:29 | 132K | |
| Company Structure-15..> | 2017-03-16 12:14 | 15K | |
| Agenda MCM No.3-2016..> | 2017-03-21 15:14 | 120K | |
| GST_Report_(comp-HUS..> | 2017-03-28 14:46 | 10K | |
| GUIDE_ON_ACCOUNTING_..> | 2017-04-07 13:15 | 1.9M | |
| TAF SPS General Prop..> | 2017-04-12 09:01 | 3.0M | |
| Customers.html | 2017-04-14 15:32 | 289K | |
| quickbook-reg..docx | 2017-04-14 17:35 | 1.5M | |
| Training requirement..> | 2017-04-17 17:49 | 8.7K | |
| SPSEVoteImportTempla..> | 2017-04-17 18:09 | 9.4K | |
| debt.xlsx | 2017-04-21 15:25 | 12K | |
| scg.txt | 2017-04-26 17:38 | 129 | |
| stock entry-item-26...> | 2017-05-04 09:12 | 24K | |
| Feedback form for ve..> | 2017-05-04 13:27 | 17K | |
| a.Cadangan.docx | 2017-05-04 16:21 | 12K | |
| Tarikh Pengiklanan.pdf | 2017-05-17 17:25 | 101K | |
| Appointment Scrutine..> | 2017-05-24 19:27 | 15K | |
| LAMPIRAN B-6(Surat A..> | 2017-06-07 12:29 | 141K | |
| LAMPIRAN B-7(Surat P..> | 2017-06-07 12:29 | 391K | |
| Appointment Scrutine..> | 2017-06-16 09:44 | 1.1K | |
| 18. Cash Advance Lis..> | 2017-07-24 10:28 | 26K | |
| UiTM MACHANG & UMT.xlsx | 2017-07-31 12:08 | 50K | |
| yauman.xlsx | 2017-08-16 19:07 | 19K | |
| odoo-cost.xlsx | 2017-10-03 10:58 | 11K | |
| MARA/ | 2017-10-03 11:27 | - | |
| pros_cons_odoo.docx | 2017-10-03 16:08 | 68K | |
| Brief Proposal Pi1M_..> | 2017-10-04 17:21 | 2.3M | |
| swifloq issues.xlsx | 2017-10-12 18:24 | 16K | |
| Cost UMT.31.7.17.xlsx | 2017-10-31 09:05 | 39K | |
| Doc1.docx | 2017-11-07 15:36 | 533K | |
| TAF UniKL Certs-ALL.pdf | 2017-11-07 16:04 | 755K | |
| Tax_Invoice_(comp-SA..> | 2017-11-10 12:55 | 26K | |
| Tax_Invoice_SALIHIN_..> | 2017-11-10 12:56 | 10K | |
| Tax_Invoice_SALIHIN_..> | 2017-11-10 12:56 | 10K | |
| tekun - biz proposit..> | 2017-11-24 13:05 | 14K | |
| GO Asia.txt | 2017-12-28 12:05 | 1.2K | |
| 18. Cash Advance Lis..> | 2018-01-05 12:26 | 26K | |
| 18. Cash Advance Lis..> | 2018-01-05 12:45 | 26K | |
| husinkhamis_19118.txt | 2018-01-19 13:36 | 502 | |
| TIME.TXT | 2018-01-25 15:20 | 512 | |
| biochempsswrd.txt | 2018-02-19 11:39 | 32 | |
| soalan customs.docx | 2018-03-02 17:32 | 16K | |
| meeting15318.txt | 2018-03-15 15:54 | 1.3K | |
| Customer_Statement_L..> | 2018-03-16 12:44 | 19K | |
| desktop.ini | 2018-03-23 12:47 | 84 | |
| CRM project/ | 2018-03-23 12:49 | - | |
| Customers_files/ | 2018-03-23 12:49 | - | |
| Desktop/ | 2018-03-23 13:00 | - | |
| DONGWHA/ | 2018-03-23 13:01 | - | |
| GST -TAX CODE MATA 8..> | 2018-03-23 13:01 | - | |
| GST_Report_(comp-HUS..> | 2018-03-23 13:02 | - | |
| HNJ Picture sb/ | 2018-03-23 13:03 | - | |
| Hussin Khamis/ | 2018-03-23 13:03 | - | |
| K.TNB/ | 2018-03-23 13:03 | - | |
| Keris Sakti/ | 2018-03-23 13:03 | - | |
| KKLW/ | 2018-03-23 13:03 | - | |
| Mampu/ | 2018-03-23 13:03 | - | |
| MiGHT/ | 2018-03-23 13:03 | - | |
| MIMOS/ | 2018-03-23 13:03 | - | |
| Proposal angkasa/ | 2018-03-23 13:04 | - | |
| Proposal Event2016/ | 2018-03-23 13:04 | - | |
| salihin 1/ | 2018-03-23 13:04 | - | |
| Salihin Portal/ | 2018-03-23 13:06 | - | |
| Sketch up/ | 2018-03-23 13:09 | - | |
| SlideGSTcode/ | 2018-03-23 13:09 | - | |
| SPSVoting/ | 2018-03-23 13:09 | - | |
| SSM sistem/ | 2018-03-23 13:09 | - | |
| Surat Dato'salleh/ | 2018-03-23 13:09 | - | |
| swifloq/ | 2018-03-23 13:09 | - | |
| TAF-UiTM/ | 2018-03-23 13:10 | - | |
| Tax_Invoice_(comp-SA..> | 2018-03-23 13:10 | - | |
| Tender SKM/ | 2018-03-23 13:10 | - | |
| Tourist Tax/ | 2018-03-23 13:10 | - | |
| UiTM/ | 2018-03-23 13:10 | - | |
| Uniten-Zakat Talk/ | 2018-03-23 13:11 | - | |
| YPJH/ | 2018-03-23 13:11 | - | |
| link-Browser.txt | 2018-03-26 10:07 | 489 | |
| GST AWARENESS WORKSH..> | 2018-03-26 10:22 | - | |
| TAF-UNIKL/ | 2018-03-26 11:11 | - | |
| LPPKN/ | 2018-04-02 15:18 | - | |
| HIDC/ | 2018-04-24 15:37 | - | |
| Bernama/ | 2018-05-23 13:58 | - | |
| Scrutineers Service/ | 2018-06-21 09:24 | - | |
| SPS-2018/ | 2018-06-28 17:06 | - | |
| swinburne/ | 2018-10-02 10:44 | - | |
| Astro Job.zip | 2018-10-25 11:07 | 6.4M | |
| Astro Job/ | 2018-11-01 18:35 | - | |
| 18. Cash Advance Lis..> | 2018-11-13 10:56 | 26K | |
| PEKEMA/ | 2018-12-21 16:12 | - | |
| 2017-sps/ | 2019-01-02 12:14 | - | |
| UMT Training/ | 2019-09-30 16:18 | - | |
| AGA GROUP/ | 2022-03-10 14:39 | - | |